| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:35 UTC |
|---|
| Update Date | 2025-03-25 00:48:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166107 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H24N2O2 |
|---|
| Molecular Mass | 276.1838 |
|---|
| SMILES | CC1CN(C(=O)Cc2ccccc2)CC1(O)CN(C)C |
|---|
| InChI Key | JCJPZNGRNWFQOC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acylpyrrolidinesorganic oxidesorganopnictogen compoundstertiary alcoholstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesn-acylpyrrolidinecarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpyrrolidinephenylacetamidetertiary amineorganoheterocyclic compoundalcoholazacycle1,2-aminoalcoholtertiary aliphatic aminecarboxamide grouptertiary alcoholorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
