| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:36 UTC |
|---|
| Update Date | 2025-03-25 00:48:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166117 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H34O3 |
|---|
| Molecular Mass | 334.2508 |
|---|
| SMILES | CC1CCCC2(C)C1CCC1C2CCC2(C)C1CCC2(O)C(=O)O |
|---|
| InChI Key | MVCMWJNYUFCTDM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | hydroxysteroids |
|---|
| Direct Parent | 17-hydroxysteroids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesandrostane steroidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidalpha-hydroxy acidhydroxy acidcyclic alcoholcarboxylic acid derivativealiphatic homopolycyclic compoundtertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundandrostane-skeletonhydrocarbon derivativeorganooxygen compound17-hydroxysteroid |
|---|
