| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:38 UTC |
|---|
| Update Date | 2025-03-25 00:48:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166220 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11Cl3O6 |
|---|
| Molecular Mass | 307.9621 |
|---|
| SMILES | CC1OC(OC(=O)C(Cl)(Cl)Cl)C(O)C(O)C1O |
|---|
| InChI Key | UMEBSHYYMXAINP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl chloridesalpha-halocarboxylic acid derivativescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholalpha-halocarboxylic acid or derivativescarbonyl groupalkyl chlorideorganochloridemonosaccharidecarboxylic acid derivativeorganohalogen compoundalpha-halocarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesacetalcarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholalkyl halidehydrocarbon derivativeoxaneorganoheterocyclic compound |
|---|