| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:39 UTC |
|---|
| Update Date | 2025-03-25 00:48:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166270 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H42O6 |
|---|
| Molecular Mass | 462.2981 |
|---|
| SMILES | CC1CC(OC2CCC3(C)C(CCC4C5CCC(=O)C5(C)CC(O)C43)C2)OC(C(=O)O)C1C |
|---|
| InChI Key | ALTUTBOIRWKMMZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | androstane steroids |
|---|
| Direct Parent | androstane steroids |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 11-hydroxysteroids17-oxosteroidsacetalscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesketonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidcarboxylic acid derivativepyran carboxylic acidketonealiphatic heteropolycyclic compoundorganic oxideacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesoxosteroidhydroxysteroidcyclic alcoholoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundandrostane-skeletonpyransecondary alcohol17-oxosteroidhydrocarbon derivative11-hydroxysteroidorganooxygen compound |
|---|