| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:40 UTC |
|---|
| Update Date | 2025-03-25 00:48:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166282 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H22O2 |
|---|
| Molecular Mass | 234.162 |
|---|
| SMILES | CC1CCC(C(C)(O)c2ccc(O)cc2)CC1 |
|---|
| InChI Key | HTRGAZWXDWPWFJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | aromatic monoterpenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaromatic alcoholsbenzene and substituted derivativeshydrocarbon derivativesmenthane monoterpenoidsmonocyclic monoterpenoidstertiary alcohols |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moietymonocyclic monoterpenoid1-hydroxy-2-unsubstituted benzenoidp-menthane monoterpenoidaromatic homomonocyclic compoundtertiary alcoholorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganooxygen compoundaromatic monoterpenoid |
|---|
