| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:44 UTC |
|---|
| Update Date | 2025-03-25 00:48:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166460 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7F3O4 |
|---|
| Molecular Mass | 212.0296 |
|---|
| SMILES | CC(=O)OC(=O)CCC(=O)C(F)(F)F |
|---|
| InChI Key | UNBQKHGOLLTHQT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | gamma-keto acids and derivatives |
|---|
| Direct Parent | gamma-keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalpha-haloketonescarboxylic acid anhydridesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganofluorides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupalkyl fluorideorganofluoridecarboxylic acid derivativeorganohalogen compoundgamma-keto acidketoneorganic oxideorganic oxygen compoundcarboxylic acid anhydridedicarboxylic acid or derivativesalpha-haloketonealkyl halidehydrocarbon derivativeorganooxygen compound |
|---|