| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:44 UTC |
|---|
| Update Date | 2025-03-25 00:48:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166464 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H24N2O8 |
|---|
| Molecular Mass | 432.1533 |
|---|
| SMILES | CC(=O)Nc1ccc(OC2OC(CNc3ccc(C(=O)O)cc3)C(O)C(O)C2O)cc1 |
|---|
| InChI Key | PEZFHPLPQGGVBI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesamino acidsbenzoic acidsbenzoyl derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundsphenylalkylaminessecondary alcoholssecondary alkylarylaminessecondary carboxylic acid amides |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acidn-acetylarylaminearomatic heteromonocyclic compoundamino acid or derivativesamino acidbenzoylmonosacchariden-arylamidecarboxylic acid derivativesaccharideorganic oxideacetalorganonitrogen compoundorganopnictogen compoundbenzoic acidoxaneorganoheterocyclic compoundacetamidealcoholacetanilidebenzoic acid or derivativessecondary aminecarboxamide groupsecondary aliphatic/aromatic amineoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenylalkylaminehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
