| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:45 UTC |
|---|
| Update Date | 2025-03-25 00:48:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166473 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H23N3O2 |
|---|
| Molecular Mass | 277.179 |
|---|
| SMILES | CC(=O)Nc1ccc(OCCN2CCN(C)CC2)cc1 |
|---|
| InChI Key | HBVLFAAFZDVPEW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesn-methylpiperazinesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | phenol ethercarbonyl groupethern-acetylarylaminearomatic heteromonocyclic compoundamino acid or derivativesn-arylamidealkyl aryl ethercarboxylic acid derivativeorganic oxidepiperazineorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundacetamideazacycleacetaniliden-alkylpiperazinetertiary aliphatic aminen-methylpiperazinecarboxamide groupsecondary carboxylic acid amideorganic oxygen compound1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
