Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:44:45 UTC |
---|
Update Date | 2025-03-25 00:48:09 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02166484 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C12H16N2O4 |
---|
Molecular Mass | 252.111 |
---|
SMILES | CC(=O)Nc1ccc(OC(CCN)C(=O)O)cc1 |
---|
InChI Key | GWEATXWJYYBAMI-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | gamma amino acids and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | acetamidesacetanilidesalkyl aryl etherscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundsphenoxyacetic acid derivativessecondary carboxylic acid amides |
---|
Substituents | phenol ethermonocyclic benzene moietyphenoxyacetatecarbonyl groupethercarboxylic acidn-acetylarylaminegamma amino acid or derivativesn-arylamidealkyl aryl etherorganic oxideorganonitrogen compoundorganopnictogen compoundacetamideacetanilidecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundphenoxy compoundorganooxygen compound |
---|