| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:45 UTC |
|---|
| Update Date | 2025-03-25 00:48:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166487 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H21NO7 |
|---|
| Molecular Mass | 351.1318 |
|---|
| SMILES | CC(=O)Nc1ccc(OC2C(C(=O)O)OC(C(=O)O)C(C)C2C)cc1 |
|---|
| InChI Key | VYDWFUMKYUOZPE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl etherscarbonyl compoundscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidn-acetylarylaminearomatic heteromonocyclic compoundn-arylamidealkyl aryl ethercarboxylic acid derivativepyran carboxylic aciddialkyl etherorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundacetamidepyran carboxylic acid or derivativesacetanilidecarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundpyrandicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|