| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:46 UTC |
|---|
| Update Date | 2025-03-25 00:48:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166517 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H13FN2O4S |
|---|
| Molecular Mass | 324.058 |
|---|
| SMILES | CC(=O)Nc1ccc(Oc2ccc(S(N)(=O)=O)cc2F)cc1 |
|---|
| InChI Key | CYKOOZSBQYPRAZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesaminosulfonyl compoundsaryl fluoridesbenzenesulfonamidesbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativesdiarylethersfluorobenzeneshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganofluoridesorganopnictogen compoundsorganosulfonamidesphenol ethersphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | aryl fluoridediaryl etherphenol etherorganosulfonic acid or derivativescarbonyl groupethern-acetylarylaminen-arylamideorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amidefluorobenzeneorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidebenzenesulfonyl groupbenzenesulfonamideaminosulfonyl compoundacetanilideorganofluoridecarboxamide grouparyl halidearomatic homomonocyclic compoundanilidesecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|