| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:46 UTC |
|---|
| Update Date | 2025-03-25 00:48:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166523 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO3 |
|---|
| Molecular Mass | 191.0582 |
|---|
| SMILES | CC(=O)Nc1cccc(C(=O)C=O)c1 |
|---|
| InChI Key | CEAOWGSINLULQC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalpha ketoaldehydesaryl ketonesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsphenylacetaldehydessecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupn-acetylarylaminebenzoyln-arylamidecarboxylic acid derivativeketoneorganic oxideorganonitrogen compoundorganopnictogen compoundalpha-ketoaldehydeacetamideacetanilidealdehydecarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundaryl ketonephenylacetaldehyde |
|---|