| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:47 UTC |
|---|
| Update Date | 2025-03-25 00:48:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166573 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11O10P |
|---|
| Molecular Mass | 298.009 |
|---|
| SMILES | CC(=O)OC1=C(O)C(=O)OC1C(O)COP(=O)(O)O |
|---|
| InChI Key | DJIHRQQDLKBOGX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | butenolidescarbonyl compoundsdicarboxylic acids and derivativesdihydrofuransenoate estershydrocarbon derivativeslactonesmonosaccharidesorganic oxidesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | carbonyl groupmonosaccharidecarboxylic acid derivativelactonealpha,beta-unsaturated carboxylic ester2-furanonesaccharideorganic oxidealiphatic heteromonocyclic compoundorganoheterocyclic compounddihydrofuranenoate esteralcoholoxacycleorganic oxygen compoundmonoalkyl phosphatecarboxylic acid estersecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|
