| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:49 UTC |
|---|
| Update Date | 2025-03-25 00:48:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166663 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18N2O3 |
|---|
| Molecular Mass | 286.1317 |
|---|
| SMILES | CC(=O)NCCC(O)C(=O)Nc1cccc2ccccc12 |
|---|
| InChI Key | YKLCSNWIXLTMBZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | gamma amino acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acids and derivativesfatty amideshydrocarbon derivativesmonosaccharidesn-arylamidesnaphthalenesorganic oxidesorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholfatty acylcarbonyl groupgamma amino acid or derivativesfatty amidemonosacchariden-arylamidearomatic homopolycyclic compoundcarboxamide groupsecondary carboxylic acid amidesaccharideorganic oxidenaphthaleneorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundacetamideorganooxygen compound |
|---|