Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:44:51 UTC |
---|
Update Date | 2025-03-25 00:48:11 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02166703 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C12H13NO7S |
---|
Molecular Mass | 315.0413 |
---|
SMILES | CC(=O)Nc1ccc(C(=O)CCC(=O)OS(=O)(=O)O)cc1 |
---|
InChI Key | PGVVBCLDLNOPEZ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbonyl compounds |
---|
Direct Parent | alkyl-phenylketones |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | acetamidesacetanilidesaryl alkyl ketonesbenzoyl derivativesbutyrophenonesgamma-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | monocyclic benzene moietysulfuric acid monoesteraryl alkyl ketonen-acetylarylaminebenzoyln-arylamidecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundacetamideorganic sulfuric acid or derivativesacetanilidecarboxamide groupgamma-keto acidbutyrophenonearomatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesketo acidhydrocarbon derivativebenzenoidorganic nitrogen compoundsulfuric acid esteralkyl-phenylketone |
---|