| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 14:44:51 UTC |
|---|
| Update Date | 2025-03-25 00:48:11 UTC |
|---|
| HMDB ID | HMDB0244393 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166713 |
|---|
| Name | Tacedinaline |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15N3O2 |
|---|
| Molecular Mass | 269.1164 |
|---|
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2ccccc2N)cc1 |
|---|
| InChI Key | VAZAPHZUAVEOMC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | benzanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesacylaminobenzoic acid and derivativesamino acids and derivativesbenzamidesbenzoyl derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsprimary aminessecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupbenzaniliden-acetylarylamineamino acid or derivativesbenzoyln-arylamidecarboxylic acid derivativebenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundacetamideacylaminobenzoic acid or derivativesacetanilidebenzoic acid or derivativescarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|