| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:51 UTC |
|---|
| Update Date | 2025-03-25 00:48:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166715 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9F3N2O2 |
|---|
| Molecular Mass | 246.0616 |
|---|
| SMILES | CC(=O)Nc1ccc(C(N)=O)c(C(F)(F)F)c1 |
|---|
| InChI Key | IXEXWARGUJCARF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | acylaminobenzoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesalkyl fluoridesbenzamidesbenzoyl derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganofluoridesorganopnictogen compoundsprimary carboxylic acid amidessecondary carboxylic acid amidestrifluoromethylbenzenes |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupn-acetylarylaminebenzoyln-arylamidecarboxylic acid derivativeorganohalogen compoundbenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundalkyl halidetrifluoromethylbenzeneacetamideacylaminobenzoic acid or derivativesacetanilidealkyl fluorideorganofluoridecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
