Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:44:51 UTC |
---|
Update Date | 2025-03-25 00:48:12 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02166741 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C11H13NO8S |
---|
Molecular Mass | 319.0362 |
---|
SMILES | CC(=O)NCCOC(=O)c1ccc(O)c(OS(=O)(=O)O)c1 |
---|
InChI Key | WKICNGNKFFXVQL-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | p-hydroxybenzoic acid alkyl esters |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetamidesbenzoyl derivativescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsphenylsulfatessecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl groupbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativephenylsulfateorganic oxideorganonitrogen compoundorganopnictogen compoundarylsulfateacetamideorganic sulfuric acid or derivativescarboxamide groupp-hydroxybenzoic acid alkyl esteraromatic homomonocyclic compoundsecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersulfate-esterphenolhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
---|