| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:52 UTC |
|---|
| Update Date | 2025-03-25 00:48:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166745 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H27N3O3 |
|---|
| Molecular Mass | 381.2052 |
|---|
| SMILES | CC(=O)NCCc1ccc(Oc2ccc(N3CCN(C(C)=O)CC3)cc2)cc1 |
|---|
| InChI Key | QVQIUYRBSJCCGO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylaminesdiarylethershydrocarbon derivativesn-arylpiperazinesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundsphenylpiperazinessecondary carboxylic acid amidestertiary carboxylic acid amides |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganic oxidepiperazinetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineorganoheterocyclic compoundacetamideazacycleaniline or substituted anilinescarboxamide groupphenylpiperazinesecondary carboxylic acid amideorganic oxygen compound1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundphenoxy compounddiphenyletheraminen-arylpiperazineorganooxygen compound |
|---|
