| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:52 UTC |
|---|
| Update Date | 2025-03-25 00:48:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166746 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H24N2O2 |
|---|
| Molecular Mass | 324.1838 |
|---|
| SMILES | CC(=O)NCCc1ccc(Oc2ccc3c(c2)CN(C)CC3)cc1 |
|---|
| InChI Key | SRACBVLBLGRLMA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | diarylethers |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaralkylaminesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amidestetrahydroisoquinolinestrialkylamines |
|---|
| Substituents | diaryl etherphenol ethermonocyclic benzene moietycarbonyl groupamino acid or derivativescarboxylic acid derivativearalkylamineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundtetrahydroisoquinolineorganopnictogen compoundtertiary amineorganoheterocyclic compoundacetamideazacycletertiary aliphatic aminecarboxamide groupsecondary carboxylic acid amidehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundamine |
|---|
