| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:56 UTC |
|---|
| Update Date | 2025-03-25 00:48:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02166934 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20N2O4 |
|---|
| Molecular Mass | 292.1423 |
|---|
| SMILES | CC(C)(C)OC(=O)NCCC(=O)c1ccccc1NC=O |
|---|
| InChI Key | MUAFOQIVLKOMGZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | anilidesaryl alkyl ketonesbenzoyl derivativescarbamate esterscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketonebenzoyln-arylamidecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundvinylogous amidecarbonic acid derivativecarbamic acid estercarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amidehydrocarbon derivativebenzenoidorganic nitrogen compoundalkyl-phenylketone |
|---|
