| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:00 UTC |
|---|
| Update Date | 2025-03-25 00:48:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02167075 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H20O5 |
|---|
| Molecular Mass | 328.1311 |
|---|
| SMILES | CC(C(=O)O)c1ccc(C(C)C(O)c2cccc(C(=O)O)c2)cc1 |
|---|
| InChI Key | AOBFKUDRXWPZIR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | sesquiterpenoids |
|---|
| Direct Parent | sesquiterpenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsaromatic monoterpenoidsbenzoic acidsbenzoyl derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesphenylpropanesphenylpropanoic acidssecondary alcoholsstilbenes |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moietycarbonyl groupcarboxylic acidbenzoylbenzoic acid or derivativesp-cymenecarboxylic acid derivativephenylpropanearomatic homomonocyclic compoundorganic oxidesesquiterpenoidorganic oxygen compound2-phenylpropanoic-acidsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebisabolane sesquiterpenoidbenzenoidbenzoic acidorganooxygen compoundstilbene |
|---|
