| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:00 UTC |
|---|
| Update Date | 2025-03-25 00:48:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02167079 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O4 |
|---|
| Molecular Mass | 244.0736 |
|---|
| SMILES | CC(C(=O)O)c1ccc(C(=O)c2ccccc2)o1 |
|---|
| InChI Key | DLMUFCSSSKMCTO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | aryl-phenylketones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl ketonesbenzoyl derivativescarboxylic acidsfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compounds |
|---|
| Substituents | furanmonocyclic benzene moietyfuroic acid or derivativescarboxylic acidaromatic heteromonocyclic compoundaryl-phenylketoneheteroaromatic compoundbenzoylcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganoheterocyclic compound |
|---|
