| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:01 UTC |
|---|
| Update Date | 2025-03-25 00:48:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02167126 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14FNO |
|---|
| Molecular Mass | 195.1059 |
|---|
| SMILES | CC(C(=O)N(C)C)c1ccc(F)cc1 |
|---|
| InChI Key | FODSPNGVDRNQCT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl fluoridescarbonyl compoundscarboxylic acids and derivativesfluorobenzeneshydrocarbon derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundstertiary carboxylic acid amides |
|---|
| Substituents | aryl fluoridecarbonyl grouporganofluoridecarboxamide groupcarboxylic acid derivativeorganohalogen compoundaryl halidearomatic homomonocyclic compoundfluorobenzeneorganic oxideorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzenephenylacetamideorganooxygen compound |
|---|
