Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:45:01 UTC |
---|
Update Date | 2025-03-25 00:48:16 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02167132 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C15H23N2O7S+ |
---|
Molecular Mass | 375.122 |
---|
SMILES | CC(C(=O)NC(Cc1ccc(OS(=O)(=O)O)cc1)C(=O)O)[N+](C)(C)C |
---|
InChI Key | PSZXYQMWGNSGBB-UHFFFAOYSA-O |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | dipeptides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alanine and derivativesalpha amino acid amidesalpha amino acidsaminesamphetamines and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsphenoxy compoundsphenylalanine and derivativesphenylpropanoic acidsphenylsulfatessecondary carboxylic acid amidessulfuric acid monoesterstetraalkylammonium salts |
---|
Substituents | monocyclic benzene moietysulfuric acid monoestercarbonyl groupcarboxylic acid3-phenylpropanoic-acidalpha-amino acid or derivativesphenylsulfateorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundarylsulfateorganic cationorganic saltamphetamine or derivativesn-acyl-alpha amino acid or derivativesorganic sulfuric acid or derivativesalpha-amino acid amidetetraalkylammonium saltn-acyl-alpha-amino acidquaternary ammonium saltcarboxamide grouparomatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundalanine or derivativessulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esteramineorganooxygen compound |
---|