| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:05 UTC |
|---|
| Update Date | 2025-03-25 00:48:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02167243 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H25NO13 |
|---|
| Molecular Mass | 427.1326 |
|---|
| SMILES | CC(=O)NC1C(OC2C(O)C(O)C(O)C(C(=O)O)C2O)OC(CO)C(O)C1OO |
|---|
| InChI Key | NECZWOJLYFDSIG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl hydroperoxidesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativescyclohexanolshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesperoxolsprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcarboxylic acidmonosaccharidehydroperoxidecarboxylic acid derivativen-acyl-alpha-hexosaminebeta-hydroxy acidorganic oxidealkyl hydroperoxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholcyclohexanolcyclitol or derivativeshydroxy acidcyclic alcoholcarboxamide groupperoxoloxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativessecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|
