| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:12 UTC |
|---|
| Update Date | 2025-03-25 00:48:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02167509 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H24N4O5S |
|---|
| Molecular Mass | 336.1467 |
|---|
| SMILES | CC(=O)NC1C(SCCCN=C(N)N)OC(CO)C(O)C1O |
|---|
| InChI Key | UVICUEKBTZHDJI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboximidamidescarboxylic acids and derivativesguanidineshydrocarbon derivativesmonothioacetalsorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspropargyl-type 1,3-dipolar organic compoundssecondary alcoholssecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | carbonyl groupguanidinemonosaccharideorganosulfur compoundcarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundmonothioacetalorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholsulfenyl compoundorganic 1,3-dipolar compoundcarboximidamidecarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|