| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:13 UTC |
|---|
| Update Date | 2025-03-25 00:48:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02167553 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H28N6O17P2S |
|---|
| Molecular Mass | 694.0707 |
|---|
| SMILES | CC(=O)NC1C(OP(=O)(O)OP(=O)(O)OCC2OC(n3cnc4c(N)ncnc43)CC2O)OC(COS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | STJSOOHOEXAOFW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl sulfatesamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesn-acyl-alpha-hexosaminesn-substituted imidazolesorganic oxidesorganic pyrophosphatesorganopnictogen compoundsoxacyclic compoundsoxanespentose phosphatesprimary aminespurine 2'-deoxyribonucleoside diphosphatespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesterstetrahydrofurans |
|---|
| Substituents | sulfuric acid monoestercarbonyl grouppentose phosphateamino acid or derivativesmonosaccharideimidazopyrimidinecarboxylic acid derivativen-acyl-alpha-hexosaminepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazolealkyl sulfateorganonitrogen compoundorganopnictogen compoundoxaneimidolactamorganoheterocyclic compoundacetamideazolen-substituted imidazolealcoholorganic sulfuric acid or derivativesazacycletetrahydrofuranheteroaromatic compoundpurine 2'-deoxyribonucleoside diphosphatecarboxamide grouporganic pyrophosphateoxacyclesecondary carboxylic acid amidephosphoric acid estermonoalkyl phosphatesecondary alcoholsulfate-esterhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundsulfuric acid esterorganic phosphoric acid derivativeaminealkyl phosphate |
|---|