| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:14 UTC |
|---|
| Update Date | 2025-03-25 00:48:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02167593 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21NO2 |
|---|
| Molecular Mass | 283.1572 |
|---|
| SMILES | CC(C)Cc1ccc(CNc2ccc(C(=O)O)cc2)cc1 |
|---|
| InChI Key | FCEWVHIILLAHAQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpropanes |
|---|
| Direct Parent | phenylpropanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acidsbenzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsphenylalkylaminessecondary alkylarylamines |
|---|
| Substituents | carboxylic acidamino acid or derivativesamino acidbenzoylbenzoic acid or derivativessecondary aminecarboxylic acid derivativesecondary aliphatic/aromatic aminephenylpropanearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenylalkylaminehydrocarbon derivativeorganic nitrogen compoundbenzoic acidamineorganooxygen compound |
|---|
