| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:18 UTC |
|---|
| Update Date | 2025-03-25 00:48:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02167736 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H23NO4 |
|---|
| Molecular Mass | 269.1627 |
|---|
| SMILES | CC(C)NCC(O)COCCc1ccc(O)c(O)c1 |
|---|
| InChI Key | ZEYJGMLCRCTXNV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesdialkyl ethersdialkylamineshydrocarbon derivativesorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | alcoholsecondary aliphatic aminemonocyclic benzene moietyether1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidsecondary aminedialkyl etheraromatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativetyrosol derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
