Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:45:19 UTC |
---|
Update Date | 2025-03-25 00:48:22 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02167754 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C18H25N3O5 |
---|
Molecular Mass | 363.1794 |
---|
SMILES | CC(C)N1CCN(c2ccc(C(=O)NC(CC(=O)O)C(=O)O)cc2)CC1 |
---|
InChI Key | DBHJUPADZAKQDM-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | aspartic acid and derivatives |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | alpha amino acidsamino acidsaminobenzamidesaniline and substituted anilinesazacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acidsdialkylarylaminesdicarboxylic acids and derivativeshippuric acids and derivativeshydrocarbon derivativesn-acyl-alpha amino acidsn-alkylpiperazinesn-arylpiperazinesorganic oxidesorganopnictogen compoundsphenylpiperazinessecondary carboxylic acid amidestrialkylamines |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acidbenzoylbenzamideorganic oxidepiperazinetertiary aliphatic/aromatic amineorganonitrogen compoundalpha-amino acidorganopnictogen compounddialkylarylamineaminobenzoic acid or derivativestertiary amineorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesazacyclen-acyl-alpha-amino acidhippuric acid or derivativesaniline or substituted anilinesn-alkylpiperazinetertiary aliphatic aminebenzoic acid or derivativescarboxamide groupaminobenzamidephenylpiperazinesecondary carboxylic acid amideorganic oxygen compound1,4-diazinaneaspartic acid or derivativesdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
---|