| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:22 UTC |
|---|
| Update Date | 2025-03-25 00:48:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02167869 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H18N2O3 |
|---|
| Molecular Mass | 274.1317 |
|---|
| SMILES | CC(C)CC1C(=O)N2C(Cc3ccc(O)cc3)C(=O)N12 |
|---|
| InChI Key | ICMAVMIYSIIQHH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2,5-dioxopiperazinesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdiazetidineshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | 1,2-diazetidinemonocyclic benzene moietycarbonyl groupazacycle1-hydroxy-2-unsubstituted benzenoid2,5-dioxopiperazineorganic oxideorganic oxygen compounddioxopiperazinepiperazinearomatic heteropolycyclic compound1,4-diazinaneorganonitrogen compoundalpha-amino acidorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|