| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:23 UTC |
|---|
| Update Date | 2025-03-25 00:48:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02167921 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C32H54O9 |
|---|
| Molecular Mass | 582.3768 |
|---|
| SMILES | CC(C)CCCC(O)C1CCC2C3CCC4CC(OC5OC(C(=O)O)C(O)C(O)C5O)CCC4(C)C3C(O)CC12C |
|---|
| InChI Key | IVYXXHOQNPYNJR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | steroidal glycosides |
|---|
| Direct Parent | steroid glucuronide conjugates |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 11-hydroxysteroidsacetalsalkyl glycosidesandrostane steroidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclic alcohols and derivativesfatty acyl glycosides of mono- and disaccharidesfatty alcoholsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | 20-hydroxysteroidfatty acylfatty acyl glycoside of mono- or disaccharidecarbonyl groupcarboxylic acidglucuronic acid or derivativeso-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidealiphatic heteropolycyclic compoundbeta-hydroxy acidsaccharideorganic oxideacetalfatty alcoholoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesfatty acyl glycosidehydroxysteroidhydroxy acidcyclic alcoholoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundandrostane-skeletonpyransecondary alcoholsteroid-glucuronide-skeletonhydrocarbon derivative11-hydroxysteroidorganooxygen compoundalkyl glycoside |
|---|
