| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:27 UTC |
|---|
| Update Date | 2025-03-25 00:48:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02168054 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H14N3O5P |
|---|
| Molecular Mass | 239.0671 |
|---|
| SMILES | CC(CCNC(=N)NP(=O)(O)O)C(=O)O |
|---|
| InChI Key | OUAUJUFOHLBWOV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | gamma amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboximidamidescarboxylic acidsfatty acids and conjugatesguanidineshydrocarbon derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidgamma amino acid or derivativesguanidineiminefatty acidcarboximidamideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|