| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:27 UTC |
|---|
| Update Date | 2025-03-25 00:48:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02168061 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H18O9 |
|---|
| Molecular Mass | 294.0951 |
|---|
| SMILES | CC(CCOC1C(C(=O)O)OC(O)C(O)C1O)C(=O)O |
|---|
| InChI Key | OLQPZVSACZAFOB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolscarbonyl compoundscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativesglucuronic acid derivativeshemiacetalsheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsmethyl-branched fatty acidsmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholsshort-chain hydroxy acids and derivatives |
|---|
| Substituents | fatty acylcarbonyl groupethercarboxylic acidshort-chain hydroxy acidglucuronic acid or derivativesheterocyclic fatty acidmonosaccharidefatty acidcarboxylic acid derivativepyran carboxylic aciddialkyl ethersaccharideorganic oxidealiphatic heteromonocyclic compoundhemiacetalhydroxy fatty acidoxaneorganoheterocyclic compound1,2-diolalcoholpyran carboxylic acid or derivativesmethyl-branched fatty acidbranched fatty acidoxacycleorganic oxygen compoundpyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativesaccharolipidorganooxygen compound |
|---|
