| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:32 UTC |
|---|
| Update Date | 2025-03-25 00:48:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02168249 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H45NO6 |
|---|
| Molecular Mass | 467.3247 |
|---|
| SMILES | CC(CCC(O)NCC(=O)O)C1CCC2C3CC(O)C4CC(O)CCC4(C)C3CC(O)C12C |
|---|
| InChI Key | NMQWTNSCNADRJS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | hydroxysteroids |
|---|
| Direct Parent | 3-hydroxysteroids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 12-hydroxysteroids25-azasteroids and derivatives6-hydroxysteroidsalpha amino acidsamino acidsbile acids, alcohols and derivativescarbonyl compoundscarboxylic acidscyclic alcohols and derivativesdialkylamineshemiaminalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | carbonyl group12-hydroxysteroidcarboxylic acidamino acid or derivativesamino acid25-azasteroidalpha-amino acid or derivativescarboxylic acid derivativebile acid, alcohol, or derivativeshemiaminalaliphatic homopolycyclic compoundorganic oxideazasteroidorganonitrogen compoundalpha-amino acidorganopnictogen compoundalkanolaminealcoholsecondary aliphatic amine3-hydroxysteroidcyclic alcoholsecondary aminemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivative6-hydroxysteroidorganic nitrogen compoundorganooxygen compoundamine |
|---|