| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:33 UTC |
|---|
| Update Date | 2025-03-25 00:48:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02168263 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C31H52O3 |
|---|
| Molecular Mass | 472.3916 |
|---|
| SMILES | CC(CCC(=O)O)C1CCC2C3CCC4C(C)(CCC5C(C)(C)C(O)CCC54C)C3CCC12C |
|---|
| InChI Key | WSILHEYNWWEJIF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | sesterterpenoids |
|---|
| Direct Parent | sesterterpenoids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | bile acids, alcohols and derivativescarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidcyclic alcoholcholane-skeletoncarboxylic acid derivativebile acid, alcohol, or derivativessesterterpenoidaliphatic homopolycyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compoundsteroid |
|---|