| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:34 UTC |
|---|
| Update Date | 2025-03-25 00:48:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02168308 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H38O4 |
|---|
| Molecular Mass | 390.277 |
|---|
| SMILES | CC(CCC(=O)O)C1(O)CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
|---|
| InChI Key | IGPKXIDETRTSDW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | bile acids, alcohols and derivatives |
|---|
| Direct Parent | bile acids, alcohols and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 17-hydroxysteroids3-hydroxy delta-5-steroidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativesdelta-5-steroidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | delta-5-steroidalcoholcarbonyl groupcarboxylic acid3-hydroxysteroidhydroxysteroid3-hydroxy-delta-5-steroidcyclic alcoholcarboxylic acid derivativebile acid, alcohol, or derivativesaliphatic homopolycyclic compoundtertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound17-hydroxysteroid |
|---|
