| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:34 UTC |
|---|
| Update Date | 2025-03-25 00:48:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02168321 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H43NO4 |
|---|
| Molecular Mass | 433.3192 |
|---|
| SMILES | CC(CCC(=O)NCC(=O)O)C1CCC2C3CCC4C(C)(O)CCC4(C)C3CCC12C |
|---|
| InChI Key | JAODDYHOERRTMM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsandrostane steroidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidestertiary alcohols |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidfatty amidealiphatic homopolycyclic compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundnorandrostane-skeletonsteroidalcoholcyclic alcoholcarboxamide groupn-acyl-aminen-acylglycinesecondary carboxylic acid amidetertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundandrostane-skeletonhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
