| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:41 UTC |
|---|
| Update Date | 2025-03-25 00:48:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02168585 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H27NO3 |
|---|
| Molecular Mass | 353.1991 |
|---|
| SMILES | CC(C)(O)C(=O)N1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
|---|
| InChI Key | VCFOUKYVTBAWMJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acylpiperidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundstertiary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | aromatic alcoholalcoholdiphenylmethanecarbonyl grouparomatic heteromonocyclic compoundazacyclecarboxamide groupcarboxylic acid derivativen-acyl-piperidinetertiary alcoholorganic oxideorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundpiperidineorganoheterocyclic compoundorganooxygen compound |
|---|
