| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:45 UTC |
|---|
| Update Date | 2025-03-25 00:48:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02168747 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H28N2O7 |
|---|
| Molecular Mass | 396.1897 |
|---|
| SMILES | CC(C)CC(NC(=O)C(Cc1ccc(O)cc1)NC(C(=O)O)C(C)O)C(=O)O |
|---|
| InChI Key | MRRRBGWDOVHXRE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | dipeptides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamino acidsamphetamines and derivativesbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkylaminesdicarboxylic acids and derivativesfatty amideshydrocarbon derivativesleucine and derivativesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundsphenylalanine and derivativessecondary alcoholssecondary carboxylic acid amidestyrosine and derivatives |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidamino acid or derivativesamino acidfatty amide1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativesbeta-hydroxy acidorganic oxideleucine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativesalcoholsecondary aliphatic aminetyrosine or derivativesalpha-amino acid amiden-acyl-alpha-amino acidhydroxy acidsecondary aminecarboxamide groupn-substituted-alpha-amino acidaromatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidephenylalanine or derivativesorganic oxygen compoundsecondary alcoholdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|