| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:50 UTC |
|---|
| Update Date | 2025-03-25 00:48:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02168916 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H17N3O3 |
|---|
| Molecular Mass | 203.127 |
|---|
| SMILES | CC(C)CC(CN(O)C(=N)N)C(=O)O |
|---|
| InChI Key | YRZFLLKCXWUMKC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | methyl-branched fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboximidamidescarboxylic acidshydrocarbon derivativesiminesmonocarboxylic acids and derivativesn-hydroxyguanidinesorganic oxidesorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidmethyl-branched fatty acidguanidineiminecarboximidamidecarboxylic acid derivativen-hydroxyguanidineorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|