| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:51 UTC |
|---|
| Update Date | 2025-03-25 00:48:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02168972 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H32O3 |
|---|
| Molecular Mass | 344.2351 |
|---|
| SMILES | CC(C)C1CCC(C)C(C)C1Oc1cccc(CC2CCC(=O)O2)c1 |
|---|
| InChI Key | HQHWQUQNMRLMHM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | terpene lactones |
|---|
| Direct Parent | terpene lactones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaromatic monoterpenoidscarbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmenthane monoterpenoidsmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesoxacyclic compoundsphenol ethersphenoxy compoundstetrahydrofurans |
|---|
| Substituents | monoterpenoidphenol ethermonocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidetheraromatic heteromonocyclic compoundalkyl aryl ethercarboxylic acid derivativelactoneterpene lactoneorganic oxideorganoheterocyclic compoundtetrahydrofurangamma butyrolactonep-menthane monoterpenoidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundaromatic monoterpenoid |
|---|
