| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:56 UTC |
|---|
| Update Date | 2025-03-25 00:48:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169137 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H22N2O6 |
|---|
| Molecular Mass | 278.1478 |
|---|
| SMILES | CC(=O)NC1C(O)C(O)C(CO)OC(O)C1N(C)C |
|---|
| InChI Key | HNXGFJKJHKBZBC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxepanes |
|---|
| Subclass | oxepanes |
|---|
| Direct Parent | oxepanes |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativescarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl groupamino acid or derivativescarboxylic acid derivativeorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalprimary alcoholtertiary amineacetamidealcoholtertiary aliphatic aminecarboxamide groupoxepaneoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|