| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:59 UTC |
|---|
| Update Date | 2025-03-25 00:48:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169265 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H22N2O |
|---|
| Molecular Mass | 234.1732 |
|---|
| SMILES | CCN(CC)CCN(C)C(=O)c1ccccc1 |
|---|
| InChI Key | XSQUKJYMJUGKMN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | amino acid or derivativestertiary aliphatic aminebenzoylcarboxamide groupcarboxylic acid derivativebenzamidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|