| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:45:59 UTC |
|---|
| Update Date | 2025-03-25 00:48:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169272 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H22N2O4 |
|---|
| Molecular Mass | 294.158 |
|---|
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(C)=O)c(O)c1 |
|---|
| InChI Key | CRXPBSAWXPWXJL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | acylaminobenzoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetamidesacetanilidesamino acids and derivativesbenzoyl derivativescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidestrialkylaminesm-hydroxybenzoic acid esters |
|---|
| Substituents | carbonyl groupn-acetylarylamineamino acid or derivativesbenzoyl1-hydroxy-2-unsubstituted benzenoidn-arylamidebenzoate estercarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundm-hydroxybenzoic acid estertertiary amineacetamideacylaminobenzoic acid or derivativesacetanilidetertiary aliphatic amine1-hydroxy-4-unsubstituted benzenoidcarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
