| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:00 UTC |
|---|
| Update Date | 2025-03-25 00:48:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169293 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H17NO2 |
|---|
| Molecular Mass | 255.1259 |
|---|
| SMILES | CCN(Cc1ccccc1)c1ccc(C(=O)O)cc1 |
|---|
| InChI Key | XRNGEQAOTMIKSR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylmethylamines |
|---|
| Direct Parent | phenylbenzamines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acidsaminobenzoic acids and derivativesaniline and substituted anilinesaralkylaminesbenzoic acidsbenzoyl derivativesbenzylaminescarboxylic acidsdialkylarylamineshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compounds |
|---|
| Substituents | carboxylic acidamino acid or derivativesamino acidbenzoylcarboxylic acid derivativearalkylamineorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compoundbenzoic aciddialkylarylamineaminobenzoic acid or derivativestertiary amineaniline or substituted anilinesbenzoic acid or derivativesaromatic homomonocyclic compoundphenylbenzaminemonocarboxylic acid or derivativesorganic oxygen compoundbenzylaminehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
