Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:46:00 UTC |
---|
Update Date | 2025-03-25 00:48:38 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02169296 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C13H17NO5 |
---|
Molecular Mass | 267.1107 |
---|
SMILES | CCN(CCOC(=O)c1ccc(O)cc1)CC(=O)O |
---|
InChI Key | DKZCEQKFQUJQSW-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | p-hydroxybenzoic acid alkyl esters |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsamino acidsbenzoyl derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundstrialkylamines |
---|
Substituents | carbonyl groupcarboxylic acidamino acid or derivativesamino acidbenzoyl1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxidealpha-amino acidorganonitrogen compoundorganopnictogen compoundtertiary aminetertiary aliphatic aminep-hydroxybenzoic acid alkyl esteraromatic homomonocyclic compoundorganic oxygen compoundcarboxylic acid esterdicarboxylic acid or derivativesphenolhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
---|