| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:00 UTC |
|---|
| Update Date | 2025-03-25 00:48:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169309 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H25NO4 |
|---|
| Molecular Mass | 283.1784 |
|---|
| SMILES | CCN(CC(O)C(O)C(O)CO)c1c(C)cccc1C |
|---|
| InChI Key | GSAJSZZXLQQMKE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | xylenes |
|---|
| Direct Parent | m-xylenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcohols1,3-aminoalcoholsaniline and substituted anilinesdialkylarylamineshydrocarbon derivativesmonosaccharidesorganopnictogen compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | alcohol1,3-aminoalcohol1,2-aminoalcoholaniline or substituted anilinesm-xylenemonosaccharidearomatic homomonocyclic compoundsaccharideorganic oxygen compoundtertiary aliphatic/aromatic amineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compounddialkylarylamineprimary alcoholaminetertiary amineorganooxygen compound |
|---|