| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:01 UTC |
|---|
| Update Date | 2025-03-25 00:48:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169316 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N3O2 |
|---|
| Molecular Mass | 209.1164 |
|---|
| SMILES | CCN(C)C(=O)c1c(O)ccc(N)c1N |
|---|
| InChI Key | MQWJXLAXRQUGLA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamino acids and derivativesbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminestertiary carboxylic acid amidesvinylogous acidsvinylogous amides |
|---|
| Substituents | amino acid or derivativesbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativebenzamideorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundvinylogous amidecarboxamide groupsalicylamidearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundphenolhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|